C14H27NSSi2 — CID 101066236
2,2,6,6-tetramethyl-1-(3-thiophen-2-ylpropyl)-1,2,6-azadisilinane (PubChem CID 101066236) has the molecular formula C14H27NSSi2 and a molecular weight of 297.62 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(3-thiophen-2-ylpropyl)-1,2,6-azadisilinane.
| Compound Name | 2,2,6,6-tetramethyl-1-(3-thiophen-2-ylpropyl)-1,2,6-azadisilinane |
|---|---|
| PubChem CID | 101066236 |
| Molecular Formula | C14H27NSSi2 |
| Molecular Weight | 297.62 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(3-thiophen-2-ylpropyl)-1,2,6-azadisilinane |
| SMILES | C[Si]1(C)CCC[Si](C)(C)N1CCCc1cccs1 |
| InChI | InChI=1S/C14H27NSSi2/c1-17(2)12-7-13-18(3,4)15(17)10-5-8-14-9-6-11-16-14/h6,9,11H,5,7-8,10,12-13H2,1-4H3 |
| InChIKey | POTHGRRGJAPGFA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|