C18H26Cl2O7 — CID 101066319
2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 2,5-dichlorobenzoate (PubChem CID 101066319) has the molecular formula C18H26Cl2O7 and a molecular weight of 425.31 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 2,5-dichlorobenzoate.
| Compound Name | 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 101066319 |
| Molecular Formula | C18H26Cl2O7 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl 2,5-dichlorobenzoate |
| SMILES | COCCOCCOCCOCCOCCOC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H26Cl2O7/c1-22-4-5-23-6-7-24-8-9-25-10-11-26-12-13-27-18(21)16-14-15(19)2-3-17(16)20/h2-3,14H,4-13H2,1H3 |
| InChIKey | YJKNEWQCUGWUSE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|