C15H20 — CID 101066408
(2Z,6Z)-13,13-dimethylbicyclo[6.4.1]trideca-2,6,9,11-tetraene (PubChem CID 101066408) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is (2Z,6Z)-13,13-dimethylbicyclo[6.4.1]trideca-2,6,9,11-tetraene.
| Compound Name | (2Z,6Z)-13,13-dimethylbicyclo[6.4.1]trideca-2,6,9,11-tetraene |
|---|---|
| PubChem CID | 101066408 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (2Z,6Z)-13,13-dimethylbicyclo[6.4.1]trideca-2,6,9,11-tetraene |
| SMILES | CC1(C)C2C=CC=CC1/C=C\CC/C=C\2 |
| InChI | InChI=1S/C15H20/c1-15(2)13-9-5-3-4-6-10-14(15)12-8-7-11-13/h5-14H,3-4H2,1-2H3/b9-5-,10-6- |
| InChIKey | VIJPDGPCUHPVRI-OZDSWYPASA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|