C13H17F3O4 — CID 101067223
cis-ethyl (1R,2R)-1-prop-2-enyl-2-(2,2,2-trifluoroacetyl)oxycyclopentane-1-carboxylate (PubChem CID 101067223) has the molecular formula C13H17F3O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-1-prop-2-enyl-2-(2,2,2-trifluoroacetyl)oxycyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-1-prop-2-enyl-2-(2,2,2-trifluoroacetyl)oxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101067223 |
| Molecular Formula | C13H17F3O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | cis-ethyl (1R,2R)-1-prop-2-enyl-2-(2,2,2-trifluoroacetyl)oxycyclopentane-1-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OCC)CCC[C@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H17F3O4/c1-3-7-12(10(17)19-4-2)8-5-6-9(12)20-11(18)13(14,15)16/h3,9H,1,4-8H2,2H3/t9-,12+/m1/s1 |
| InChIKey | HOYWPPWIQFHQRI-SKDRFNHKSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|