C21H38O2Si — CID 101067971
4-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]-1-methylcyclopent-2-en-1-ol (PubChem CID 101067971) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is 4-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]-1-methylcyclopent-2-en-1-ol.
| Compound Name | 4-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]-1-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 101067971 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 4-[(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohex-2-en-1-yl]-1-methylcyclopent-2-en-1-ol |
| SMILES | CC1=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]1C1C=CC(C)(O)C1 |
| InChI | InChI=1S/C21H38O2Si/c1-15-10-11-17(23-24(8,9)19(2,3)4)20(5,6)18(15)16-12-13-21(7,22)14-16/h10,12-13,16-18,22H,11,14H2,1-9H3/t16?,17-,18-,21?/m0/s1 |
| InChIKey | CGVLXRXWHRUAOQ-KQNFGGRRSA-N |
| XLogP | 5.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|