About 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid
3-methylimidazo[4,5-f]quinoline-2-sulfonic acid (PubChem CID 10106806) has the molecular formula C11H9N3O3S
and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid.
Molecular Properties
| Compound Name | 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid |
| PubChem CID | 10106806 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid |
| SMILES | Cn1c(S(=O)(=O)O)nc2c3cccnc3ccc21 |
| InChI | InChI=1S/C11H9N3O3S/c1-14-9-5-4-8-7(3-2-6-12-8)10(9)13-11(14)18(15,16)17/h2-6H,1H3,(H,15,16,17) |
| InChIKey | SXYFKSSUPNLTPT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid?
The IUPAC name of 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid (CID 10106806) is 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid.
What is the SMILES notation for 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid?
The canonical SMILES for 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid is Cn1c(S(=O)(=O)O)nc2c3cccnc3ccc21.
What is the InChIKey of 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid?
The InChIKey is SXYFKSSUPNLTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O3S/c1-14-9-5-4-8-7(3-2-6-12-8)10(9)13-11(14)18(15,16)17/h2-6H,1H3,(H,15,16,17).
What are the key properties of 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid?
3-methylimidazo[4,5-f]quinoline-2-sulfonic acid has a molecular weight of 263.28 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylimidazo[4,5-f]quinoline-2-sulfonic acid is sourced from PubChem (CID 10106806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).