C18H29NO4Si — CID 101068060
ethyl 2-[tert-butyl(dimethyl)silyl]-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 101068060) has the molecular formula C18H29NO4Si and a molecular weight of 351.52 g/mol. Its IUPAC name is ethyl 2-[tert-butyl(dimethyl)silyl]-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | ethyl 2-[tert-butyl(dimethyl)silyl]-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 101068060 |
| Molecular Formula | C18H29NO4Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | ethyl 2-[tert-butyl(dimethyl)silyl]-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | CCOC(=O)C(NC(=O)OCc1ccccc1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29NO4Si/c1-7-22-16(20)15(24(5,6)18(2,3)4)19-17(21)23-13-14-11-9-8-10-12-14/h8-12,15H,7,13H2,1-6H3,(H,19,21) |
| InChIKey | WYLZHYSGYMGMEF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|