C20H33NO4Si — CID 101068065
benzyl 2-[tert-butyl(dimethyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 101068065) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is benzyl 2-[tert-butyl(dimethyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | benzyl 2-[tert-butyl(dimethyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 101068065 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | benzyl 2-[tert-butyl(dimethyl)silyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)OCc1ccccc1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33NO4Si/c1-19(2,3)25-18(23)21-16(26(7,8)20(4,5)6)17(22)24-14-15-12-10-9-11-13-15/h9-13,16H,14H2,1-8H3,(H,21,23) |
| InChIKey | MQSVLSOYCJICTL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|