C15H26O2 — CID 101068119
(1R,3aR,7R,7aS)-7-(ethoxymethoxy)-1-prop-2-enyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 101068119) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,3aR,7R,7aS)-7-(ethoxymethoxy)-1-prop-2-enyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | (1R,3aR,7R,7aS)-7-(ethoxymethoxy)-1-prop-2-enyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 101068119 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,3aR,7R,7aS)-7-(ethoxymethoxy)-1-prop-2-enyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | C=CC[C@H]1CC[C@H]2CCC[C@@H](OCOCC)[C@@H]21 |
| InChI | InChI=1S/C15H26O2/c1-3-6-12-9-10-13-7-5-8-14(15(12)13)17-11-16-4-2/h3,12-15H,1,4-11H2,2H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | CXLJWTOQJHXBQO-GBJTYRQASA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|