About 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine
2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine (PubChem CID 10106828) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine.
Molecular Properties
| Compound Name | 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine |
| PubChem CID | 10106828 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine |
| SMILES | CCCCCC/C=C/C=C/CCC1CCCN1CC |
| InChI | InChI=1S/C18H33N/c1-3-5-6-7-8-9-10-11-12-13-15-18-16-14-17-19(18)4-2/h9-12,18H,3-8,13-17H2,1-2H3/b10-9+,12-11+ |
| InChIKey | HYHSNERERATHEB-HULFFUFUSA-N |
| XLogP | 5.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine?
The IUPAC name of 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine (CID 10106828) is 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine.
What is the SMILES notation for 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine?
The canonical SMILES for 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine is CCCCCC/C=C/C=C/CCC1CCCN1CC.
What is the InChIKey of 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine?
The InChIKey is HYHSNERERATHEB-HULFFUFUSA-N. The full InChI is InChI=1S/C18H33N/c1-3-5-6-7-8-9-10-11-12-13-15-18-16-14-17-19(18)4-2/h9-12,18H,3-8,13-17H2,1-2H3/b10-9+,12-11+.
What are the key properties of 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine?
2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine has a molecular weight of 263.47 g/mol, XLogP of 5.33, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E,5E)-dodeca-3,5-dienyl]-1-ethylpyrrolidine is sourced from PubChem (CID 10106828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).