C15H25N2O10- — CID 101068428
(2R,3R,4S,5R,6S)-6-[[(1S)-1-carboxy-5-[[(1R)-1-carboxyethyl]amino]pentyl]carbamoyl]-3,4,5-trihydroxyoxan-2-olate (PubChem CID 101068428) has the molecular formula C15H25N2O10- and a molecular weight of 393.37 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-6-[[(1S)-1-carboxy-5-[[(1R)-1-carboxyethyl]amino]pentyl]carbamoyl]-3,4,5-trihydroxyoxan-2-olate.
| Compound Name | (2R,3R,4S,5R,6S)-6-[[(1S)-1-carboxy-5-[[(1R)-1-carboxyethyl]amino]pentyl]carbamoyl]-3,4,5-trihydroxyoxan-2-olate |
|---|---|
| PubChem CID | 101068428 |
| Molecular Formula | C15H25N2O10- |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (2R,3R,4S,5R,6S)-6-[[(1S)-1-carboxy-5-[[(1R)-1-carboxyethyl]amino]pentyl]carbamoyl]-3,4,5-trihydroxyoxan-2-olate |
| SMILES | C[C@@H](NCCCC[C@H](NC(=O)[C@H]1O[C@@H]([O-])[C@H](O)[C@@H](O)[C@H]1O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H25N2O10/c1-6(13(22)23)16-5-3-2-4-7(14(24)25)17-12(21)11-9(19)8(18)10(20)15(26)27-11/h6-11,15-16,18-20H,2-5H2,1H3,(H,17,21)(H,22,23)(H,24,25)/q-1/t6-,7+,8+,9-,10-,11+,15-/m1/s1 |
| InChIKey | WSTIIDFPCDWZTJ-RBOYNLMKSA-N |
| XLogP | -4.04 |
| TPSA | 208.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|