C20H34O4Si — CID 101068585
(1S,2R,5R,6R,7S)-5-methoxy-1-methyl-7-tri(propan-2-yl)silyloxy-10-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 101068585) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-5-methoxy-1-methyl-7-tri(propan-2-yl)silyloxy-10-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,5R,6R,7S)-5-methoxy-1-methyl-7-tri(propan-2-yl)silyloxy-10-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 101068585 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (1S,2R,5R,6R,7S)-5-methoxy-1-methyl-7-tri(propan-2-yl)silyloxy-10-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CO[C@@H]1CC(=O)[C@@H]2[C@H]1[C@@]1(O[Si](C(C)C)(C(C)C)C(C)C)C=C[C@]2(C)O1 |
| InChI | InChI=1S/C20H34O4Si/c1-12(2)25(13(3)4,14(5)6)24-20-10-9-19(7,23-20)17-15(21)11-16(22-8)18(17)20/h9-10,12-14,16-18H,11H2,1-8H3/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | QXLMKUAYBJTYJF-SLHNCBLASA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|