C13H13ClN2O2 — CID 10106887
methyl 2-[[(Z)-3-(2-chlorophenyl)-2-cyanoprop-1-enyl]amino]acetate (PubChem CID 10106887) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is methyl 2-[[(Z)-3-(2-chlorophenyl)-2-cyanoprop-1-enyl]amino]acetate.
| Compound Name | methyl 2-[[(Z)-3-(2-chlorophenyl)-2-cyanoprop-1-enyl]amino]acetate |
|---|---|
| PubChem CID | 10106887 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl 2-[[(Z)-3-(2-chlorophenyl)-2-cyanoprop-1-enyl]amino]acetate |
| SMILES | COC(=O)CN/C=C(\C#N)Cc1ccccc1Cl |
| InChI | InChI=1S/C13H13ClN2O2/c1-18-13(17)9-16-8-10(7-15)6-11-4-2-3-5-12(11)14/h2-5,8,16H,6,9H2,1H3/b10-8- |
| InChIKey | CTKXILYGKCHKFP-NTMALXAHSA-N |
| XLogP | 2.05 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|