C19H33NO3 — CID 101068990
tert-butyl (2R,3S,6R)-2-ethoxy-6-methyl-2,3-bis(prop-2-enyl)piperidine-1-carboxylate (PubChem CID 101068990) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is tert-butyl (2R,3S,6R)-2-ethoxy-6-methyl-2,3-bis(prop-2-enyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,6R)-2-ethoxy-6-methyl-2,3-bis(prop-2-enyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101068990 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | tert-butyl (2R,3S,6R)-2-ethoxy-6-methyl-2,3-bis(prop-2-enyl)piperidine-1-carboxylate |
| SMILES | C=CC[C@@H]1CC[C@@H](C)N(C(=O)OC(C)(C)C)[C@]1(CC=C)OCC |
| InChI | InChI=1S/C19H33NO3/c1-8-11-16-13-12-15(4)20(17(21)23-18(5,6)7)19(16,14-9-2)22-10-3/h8-9,15-16H,1-2,10-14H2,3-7H3/t15-,16-,19-/m1/s1 |
| InChIKey | CXQZQRINGTXOLW-GPMSIDNRSA-N |
| XLogP | 4.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|