About 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea
1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea (PubChem CID 10106934) has the molecular formula C9H16ClN3O4
and a molecular weight of 265.70 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea.
Molecular Properties
| Compound Name | 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea |
| PubChem CID | 10106934 |
| Molecular Formula | C9H16ClN3O4 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea |
| SMILES | CC1(C)OCC(NC(=O)N(CCCl)N=O)CO1 |
| InChI | InChI=1S/C9H16ClN3O4/c1-9(2)16-5-7(6-17-9)11-8(14)13(12-15)4-3-10/h7H,3-6H2,1-2H3,(H,11,14) |
| InChIKey | TVSHIWRGZFHMMG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea?
The IUPAC name of 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea (CID 10106934) is 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea.
What is the SMILES notation for 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea?
The canonical SMILES for 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea is CC1(C)OCC(NC(=O)N(CCCl)N=O)CO1.
What is the InChIKey of 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea?
The InChIKey is TVSHIWRGZFHMMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3O4/c1-9(2)16-5-7(6-17-9)11-8(14)13(12-15)4-3-10/h7H,3-6H2,1-2H3,(H,11,14).
What are the key properties of 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea?
1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea has a molecular weight of 265.70 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethyl)-3-(2,2-dimethyl-1,3-dioxan-5-yl)-1-nitrosourea is sourced from PubChem (CID 10106934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).