C11H11FN4O3 — CID 10106948
N-(2-fluoro-5-nitrophenyl)-3,6-dihydro-1H-pyridazine-2-carboxamide (PubChem CID 10106948) has the molecular formula C11H11FN4O3 and a molecular weight of 266.23 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-3,6-dihydro-1H-pyridazine-2-carboxamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-3,6-dihydro-1H-pyridazine-2-carboxamide |
|---|---|
| PubChem CID | 10106948 |
| Molecular Formula | C11H11FN4O3 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-3,6-dihydro-1H-pyridazine-2-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1F)N1CC=CCN1 |
| InChI | InChI=1S/C11H11FN4O3/c12-9-4-3-8(16(18)19)7-10(9)14-11(17)15-6-2-1-5-13-15/h1-4,7,13H,5-6H2,(H,14,17) |
| InChIKey | OKCHSDHLEXGHJL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|