C25H33NO4S — CID 101069720
N-[(2S,3R,4R)-3-ethynyl-4-hydroxy-5-methyl-1-phenylhexan-2-yl]-4-methoxy-2,3,5-trimethylbenzenesulfonamide (PubChem CID 101069720) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is N-[(2S,3R,4R)-3-ethynyl-4-hydroxy-5-methyl-1-phenylhexan-2-yl]-4-methoxy-2,3,5-trimethylbenzenesulfonamide.
| Compound Name | N-[(2S,3R,4R)-3-ethynyl-4-hydroxy-5-methyl-1-phenylhexan-2-yl]-4-methoxy-2,3,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 101069720 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[(2S,3R,4R)-3-ethynyl-4-hydroxy-5-methyl-1-phenylhexan-2-yl]-4-methoxy-2,3,5-trimethylbenzenesulfonamide |
| SMILES | C#C[C@H]([C@H](Cc1ccccc1)NS(=O)(=O)c1cc(C)c(OC)c(C)c1C)[C@H](O)C(C)C |
| InChI | InChI=1S/C25H33NO4S/c1-8-21(24(27)16(2)3)22(15-20-12-10-9-11-13-20)26-31(28,29)23-14-17(4)25(30-7)19(6)18(23)5/h1,9-14,16,21-22,24,26-27H,15H2,2-7H3/t21-,22+,24-/m1/s1 |
| InChIKey | SIUTVCMDAVVOJI-AOHZBQACSA-N |
| XLogP | 3.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|