C19H25NO4 — CID 101069817
(4S)-3-[(2R)-4-methyl-2-phenylmethoxypent-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 101069817) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (4S)-3-[(2R)-4-methyl-2-phenylmethoxypent-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R)-4-methyl-2-phenylmethoxypent-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101069817 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (4S)-3-[(2R)-4-methyl-2-phenylmethoxypent-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | C=C(C)C[C@@H](OCc1ccccc1)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C19H25NO4/c1-13(2)10-17(23-11-15-8-6-5-7-9-15)18(21)20-16(14(3)4)12-24-19(20)22/h5-9,14,16-17H,1,10-12H2,2-4H3/t16-,17-/m1/s1 |
| InChIKey | SBCJOLUVJABFJF-IAGOWNOFSA-N |
| XLogP | 3.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|