About [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate
[2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate (PubChem CID 10107) has the molecular formula C12H14Cl3O4P
and a molecular weight of 359.57 g/mol. Its IUPAC name is [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate.
Molecular Properties
| Compound Name | [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate |
| PubChem CID | 10107 |
| Molecular Formula | C12H14Cl3O4P |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC(=CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl3O4P/c1-3-17-20(16,18-4-2)19-12(8-13)10-6-5-9(14)7-11(10)15/h5-8H,3-4H2,1-2H3 |
| InChIKey | FSAVDKDHPDSCTO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate?
The IUPAC name of [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate (CID 10107) is [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate.
What is the SMILES notation for [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate?
The canonical SMILES for [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate is CCOP(=O)(OCC)OC(=CCl)c1ccc(Cl)cc1Cl.
What is the InChIKey of [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate?
The InChIKey is FSAVDKDHPDSCTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl3O4P/c1-3-17-20(16,18-4-2)19-12(8-13)10-6-5-9(14)7-11(10)15/h5-8H,3-4H2,1-2H3.
What are the key properties of [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate?
[2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate has a molecular weight of 359.57 g/mol, XLogP of 5.73, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-1-(2,4-dichlorophenyl)ethenyl] diethyl phosphate is sourced from PubChem (CID 10107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).