C25H41NO3Si — CID 101070308
ethyl 2-[(2S,3S,4S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-1-en-2-ylpyrrolidin-3-yl]acetate (PubChem CID 101070308) has the molecular formula C25H41NO3Si and a molecular weight of 431.69 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-1-en-2-ylpyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-1-en-2-ylpyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 101070308 |
| Molecular Formula | C25H41NO3Si |
| Molecular Weight | 431.69 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | ethyl 2-[(2S,3S,4S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-1-en-2-ylpyrrolidin-3-yl]acetate |
| SMILES | C=C(C)[C@H]1CN(Cc2ccccc2)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CC(=O)OCC |
| InChI | InChI=1S/C25H41NO3Si/c1-9-28-24(27)15-21-22(19(2)3)17-26(16-20-13-11-10-12-14-20)23(21)18-29-30(7,8)25(4,5)6/h10-14,21-23H,2,9,15-18H2,1,3-8H3/t21-,22+,23+/m0/s1 |
| InChIKey | JUUNHBNPZQMSJR-YTFSRNRJSA-N |
| XLogP | 5.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|