C22H36O3Si — CID 101070845
(7S,8S,9R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]tricyclo[7.4.1.02,7]tetradec-1-ene-10,14-dione (PubChem CID 101070845) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is (7S,8S,9R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]tricyclo[7.4.1.02,7]tetradec-1-ene-10,14-dione.
| Compound Name | (7S,8S,9R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]tricyclo[7.4.1.02,7]tetradec-1-ene-10,14-dione |
|---|---|
| PubChem CID | 101070845 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (7S,8S,9R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]tricyclo[7.4.1.02,7]tetradec-1-ene-10,14-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1[C@@H]2C(=O)CCCC(=C3CCCC[C@H]31)C2=O |
| InChI | InChI=1S/C22H36O3Si/c1-22(2,3)26(4,5)25-14-13-17-15-9-6-7-10-16(15)18-11-8-12-19(23)20(17)21(18)24/h15,17,20H,6-14H2,1-5H3/t15-,17+,20-/m1/s1 |
| InChIKey | UDAXMABABCOCTQ-OXFYSEKESA-N |
| XLogP | 5.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|