C19H36O5Si — CID 101070904
[(2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 101070904) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101070904 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C19H36O5Si/c1-10-11-13-15(20)16(24-25(8,9)19(5,6)7)14(23-13)12-22-17(21)18(2,3)4/h10,13-16,20H,1,11-12H2,2-9H3/t13-,14+,15-,16-/m0/s1 |
| InChIKey | WYWVBYYEHUEMBW-FZKCQIBNSA-N |
| XLogP | 3.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|