C20H38O5Si — CID 101070905
2-[(2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 101070905) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101070905 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-prop-2-enyloxolan-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H]1O[C@@H](CCOC(=O)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C20H38O5Si/c1-10-11-14-16(21)17(25-26(8,9)20(5,6)7)15(24-14)12-13-23-18(22)19(2,3)4/h10,14-17,21H,1,11-13H2,2-9H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | UOWBKXDOTKDZQB-YYIAUSFCSA-N |
| XLogP | 4.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|