C24H26N2O9S — CID 101072210
methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(naphthalen-2-ylcarbamothioylamino)oxane-2-carboxylate (PubChem CID 101072210) has the molecular formula C24H26N2O9S and a molecular weight of 518.54 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(naphthalen-2-ylcarbamothioylamino)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(naphthalen-2-ylcarbamothioylamino)oxane-2-carboxylate |
|---|---|
| PubChem CID | 101072210 |
| Molecular Formula | C24H26N2O9S |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(naphthalen-2-ylcarbamothioylamino)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](NC(=S)Nc2ccc3ccccc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H26N2O9S/c1-12(27)32-18-19(33-13(2)28)21(23(30)31-4)35-22(20(18)34-14(3)29)26-24(36)25-17-10-9-15-7-5-6-8-16(15)11-17/h5-11,18-22H,1-4H3,(H2,25,26,36)/t18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | NXRIPZSCQTWXCM-BIRZXAFVSA-N |
| XLogP | 1.82 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|