About 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole
1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole (PubChem CID 101072422) has the molecular formula C10H16N2S2
and a molecular weight of 228.39 g/mol. Its IUPAC name is 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole |
| PubChem CID | 101072422 |
| Molecular Formula | C10H16N2S2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole |
| SMILES | CN1CCC=C1SSC1=CCCN1C |
| InChI | InChI=1S/C10H16N2S2/c1-11-7-3-5-9(11)13-14-10-6-4-8-12(10)2/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | UYPMIPADNWIMAO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole?
The IUPAC name of 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole (CID 101072422) is 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole.
What is the SMILES notation for 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole?
The canonical SMILES for 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole is CN1CCC=C1SSC1=CCCN1C.
What is the InChIKey of 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole?
The InChIKey is UYPMIPADNWIMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S2/c1-11-7-3-5-9(11)13-14-10-6-4-8-12(10)2/h5-6H,3-4,7-8H2,1-2H3.
What are the key properties of 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole?
1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole has a molecular weight of 228.39 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-[(1-methyl-2,3-dihydropyrrol-5-yl)disulfanyl]-2,3-dihydropyrrole is sourced from PubChem (CID 101072422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).