C18H30O3 — CID 101072501
(4S)-2-butyl-4-methoxy-6-methyl-3-propan-2-yloxy-4-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 101072501) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (4S)-2-butyl-4-methoxy-6-methyl-3-propan-2-yloxy-4-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | (4S)-2-butyl-4-methoxy-6-methyl-3-propan-2-yloxy-4-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 101072501 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (4S)-2-butyl-4-methoxy-6-methyl-3-propan-2-yloxy-4-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)[C@@]1(OC)CC(C)C(=O)C(CCCC)=C1OC(C)C |
| InChI | InChI=1S/C18H30O3/c1-8-9-10-15-16(19)14(6)11-18(20-7,12(2)3)17(15)21-13(4)5/h13-14H,2,8-11H2,1,3-7H3/t14?,18-/m0/s1 |
| InChIKey | DFOQKWXMHWDKKU-IBYPIGCZSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|