C25H43IO2Si — CID 101073553
[(1R,6R,8aS)-1-[(Z)-4-iodobut-3-enyl]-6-methoxy-8a-methyl-6-prop-2-enyl-3,5,7,8-tetrahydro-2H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101073553) has the molecular formula C25H43IO2Si and a molecular weight of 530.61 g/mol. Its IUPAC name is [(1R,6R,8aS)-1-[(Z)-4-iodobut-3-enyl]-6-methoxy-8a-methyl-6-prop-2-enyl-3,5,7,8-tetrahydro-2H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,6R,8aS)-1-[(Z)-4-iodobut-3-enyl]-6-methoxy-8a-methyl-6-prop-2-enyl-3,5,7,8-tetrahydro-2H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101073553 |
| Molecular Formula | C25H43IO2Si |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [(1R,6R,8aS)-1-[(Z)-4-iodobut-3-enyl]-6-methoxy-8a-methyl-6-prop-2-enyl-3,5,7,8-tetrahydro-2H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@]1(OC)CC[C@@]2(C)C(=CCC[C@]2(CC/C=C\I)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H43IO2Si/c1-9-14-24(27-6)18-17-23(5)21(20-24)13-12-16-25(23,15-10-11-19-26)28-29(7,8)22(2,3)4/h9,11,13,19H,1,10,12,14-18,20H2,2-8H3/b19-11-/t23-,24-,25-/m0/s1 |
| InChIKey | ZGYWMVBWHVFSAJ-TWZWYUNMSA-N |
| XLogP | 8.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|