C23H34O4SSi — CID 101073805
(1R,6R,6aR)-1-(benzenesulfonyl)-6-tri(propan-2-yl)silyloxy-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 101073805) has the molecular formula C23H34O4SSi and a molecular weight of 434.67 g/mol. Its IUPAC name is (1R,6R,6aR)-1-(benzenesulfonyl)-6-tri(propan-2-yl)silyloxy-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (1R,6R,6aR)-1-(benzenesulfonyl)-6-tri(propan-2-yl)silyloxy-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 101073805 |
| Molecular Formula | C23H34O4SSi |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (1R,6R,6aR)-1-(benzenesulfonyl)-6-tri(propan-2-yl)silyloxy-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CC(C)[Si](O[C@@H]1CCC2=CC(=O)[C@H](S(=O)(=O)c3ccccc3)[C@H]21)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H34O4SSi/c1-15(2)29(16(3)4,17(5)6)27-21-13-12-18-14-20(24)23(22(18)21)28(25,26)19-10-8-7-9-11-19/h7-11,14-17,21-23H,12-13H2,1-6H3/t21-,22-,23+/m1/s1 |
| InChIKey | SNHGCALQWYKRJE-ZLNRFVROSA-N |
| XLogP | 5.31 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|