C20H36O3Si — CID 101073952
(4Z,5S,6S,10S)-4-(2,2-dimethylpropylidene)-2,2,6,8,8,10-hexamethyl-6-prop-2-enyl-1,7,9-trioxa-2-silaspiro[4.5]decane (PubChem CID 101073952) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is (4Z,5S,6S,10S)-4-(2,2-dimethylpropylidene)-2,2,6,8,8,10-hexamethyl-6-prop-2-enyl-1,7,9-trioxa-2-silaspiro[4.5]decane.
| Compound Name | (4Z,5S,6S,10S)-4-(2,2-dimethylpropylidene)-2,2,6,8,8,10-hexamethyl-6-prop-2-enyl-1,7,9-trioxa-2-silaspiro[4.5]decane |
|---|---|
| PubChem CID | 101073952 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (4Z,5S,6S,10S)-4-(2,2-dimethylpropylidene)-2,2,6,8,8,10-hexamethyl-6-prop-2-enyl-1,7,9-trioxa-2-silaspiro[4.5]decane |
| SMILES | C=CC[C@]1(C)OC(C)(C)O[C@@H](C)[C@]12O[Si](C)(C)C/C2=C\C(C)(C)C |
| InChI | InChI=1S/C20H36O3Si/c1-11-12-19(8)20(15(2)21-18(6,7)22-19)16(13-17(3,4)5)14-24(9,10)23-20/h11,13,15H,1,12,14H2,2-10H3/b16-13+/t15-,19-,20+/m0/s1 |
| InChIKey | JLRSDFVVKPGXRV-LMPCMYQISA-N |
| XLogP | 5.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|