C16H30O7Si — CID 101073985
[(Z,1S)-1-[(4R,5R)-2,2-ditert-butyl-5-hydroxy-1,3,2-dioxasilinan-4-yl]-2,3-dihydroxyprop-2-enyl] acetate (PubChem CID 101073985) has the molecular formula C16H30O7Si and a molecular weight of 362.50 g/mol. Its IUPAC name is [(Z,1S)-1-[(4R,5R)-2,2-ditert-butyl-5-hydroxy-1,3,2-dioxasilinan-4-yl]-2,3-dihydroxyprop-2-enyl] acetate.
| Compound Name | [(Z,1S)-1-[(4R,5R)-2,2-ditert-butyl-5-hydroxy-1,3,2-dioxasilinan-4-yl]-2,3-dihydroxyprop-2-enyl] acetate |
|---|---|
| PubChem CID | 101073985 |
| Molecular Formula | C16H30O7Si |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [(Z,1S)-1-[(4R,5R)-2,2-ditert-butyl-5-hydroxy-1,3,2-dioxasilinan-4-yl]-2,3-dihydroxyprop-2-enyl] acetate |
| SMILES | CC(=O)O[C@H](/C(O)=C/O)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]1O |
| InChI | InChI=1S/C16H30O7Si/c1-10(18)22-13(11(19)8-17)14-12(20)9-21-24(23-14,15(2,3)4)16(5,6)7/h8,12-14,17,19-20H,9H2,1-7H3/b11-8-/t12-,13-,14-/m1/s1 |
| InChIKey | QRVFPGVDARARQC-QSESBOCJSA-N |
| XLogP | 2.69 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|