C14H18N4O2 — CID 10107400
N',N'-dimethyl-N-(6-nitroquinolin-4-yl)propane-1,3-diamine (PubChem CID 10107400) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N',N'-dimethyl-N-(6-nitroquinolin-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(6-nitroquinolin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 10107400 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N',N'-dimethyl-N-(6-nitroquinolin-4-yl)propane-1,3-diamine |
| SMILES | CN(C)CCCNc1ccnc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C14H18N4O2/c1-17(2)9-3-7-15-14-6-8-16-13-5-4-11(18(19)20)10-12(13)14/h4-6,8,10H,3,7,9H2,1-2H3,(H,15,16) |
| InChIKey | YRCLBSXRUSAIST-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|