C18H26O2 — CID 10107418
1-methoxy-4-[[(4S)-4-propan-2-ylcyclohexen-1-yl]methoxymethyl]benzene (PubChem CID 10107418) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-methoxy-4-[[(4S)-4-propan-2-ylcyclohexen-1-yl]methoxymethyl]benzene.
| Compound Name | 1-methoxy-4-[[(4S)-4-propan-2-ylcyclohexen-1-yl]methoxymethyl]benzene |
|---|---|
| PubChem CID | 10107418 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-methoxy-4-[[(4S)-4-propan-2-ylcyclohexen-1-yl]methoxymethyl]benzene |
| SMILES | COc1ccc(COCC2=CC[C@@H](C(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H26O2/c1-14(2)17-8-4-15(5-9-17)12-20-13-16-6-10-18(19-3)11-7-16/h4,6-7,10-11,14,17H,5,8-9,12-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | NVICMGGWQYPJQB-QGZVFWFLSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|