C16H19N5O4 — CID 101074287
1,3-dimethyl-5-[(2-methyl-3-oxo-5-pyrrolidin-1-ylpyridazin-4-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 101074287) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(2-methyl-3-oxo-5-pyrrolidin-1-ylpyridazin-4-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[(2-methyl-3-oxo-5-pyrrolidin-1-ylpyridazin-4-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 101074287 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1,3-dimethyl-5-[(2-methyl-3-oxo-5-pyrrolidin-1-ylpyridazin-4-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2c(N3CCCC3)cnn(C)c2=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C16H19N5O4/c1-18-13(22)11(14(23)19(2)16(18)25)8-10-12(21-6-4-5-7-21)9-17-20(3)15(10)24/h8-9H,4-7H2,1-3H3 |
| InChIKey | POIJRLVPBOCYFZ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 95.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|