C17H19ClO — CID 10107433
(1R,2E,3R,5R,7R)-2-benzylidene-5-chloroadamantan-1-ol (PubChem CID 10107433) has the molecular formula C17H19ClO and a molecular weight of 274.79 g/mol. Its IUPAC name is (1R,2E,3R,5R,7R)-2-benzylidene-5-chloroadamantan-1-ol.
| Compound Name | (1R,2E,3R,5R,7R)-2-benzylidene-5-chloroadamantan-1-ol |
|---|---|
| PubChem CID | 10107433 |
| Molecular Formula | C17H19ClO |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (1R,2E,3R,5R,7R)-2-benzylidene-5-chloroadamantan-1-ol |
| SMILES | O[C@]12C[C@H]3C[C@H](C[C@](Cl)(C3)C1)/C2=C\c1ccccc1 |
| InChI | InChI=1S/C17H19ClO/c18-16-8-13-6-14(10-16)15(17(19,9-13)11-16)7-12-4-2-1-3-5-12/h1-5,7,13-14,19H,6,8-11H2/b15-7+/t13-,14+,16+,17+/m0/s1 |
| InChIKey | FOAIFKRDZJGAPH-UKVUEBOGSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|