C40H46O9 — CID 101074714
[(2R,4S)-4-hydroxy-2-[(S)-(6-methoxy-1,3-benzodioxol-5-yl)-(methoxymethoxy)methyl]-5-trityloxypentyl] 2,2-dimethylpropanoate (PubChem CID 101074714) has the molecular formula C40H46O9 and a molecular weight of 670.80 g/mol. Its IUPAC name is [(2R,4S)-4-hydroxy-2-[(S)-(6-methoxy-1,3-benzodioxol-5-yl)-(methoxymethoxy)methyl]-5-trityloxypentyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,4S)-4-hydroxy-2-[(S)-(6-methoxy-1,3-benzodioxol-5-yl)-(methoxymethoxy)methyl]-5-trityloxypentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101074714 |
| Molecular Formula | C40H46O9 |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | [(2R,4S)-4-hydroxy-2-[(S)-(6-methoxy-1,3-benzodioxol-5-yl)-(methoxymethoxy)methyl]-5-trityloxypentyl] 2,2-dimethylpropanoate |
| SMILES | COCOC(c1cc2c(cc1OC)OCO2)[C@@H](COC(=O)C(C)(C)C)C[C@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H46O9/c1-39(2,3)38(42)45-24-28(37(48-26-43-4)33-22-35-36(47-27-46-35)23-34(33)44-5)21-32(41)25-49-40(29-15-9-6-10-16-29,30-17-11-7-12-18-30)31-19-13-8-14-20-31/h6-20,22-23,28,32,37,41H,21,24-27H2,1-5H3/t28-,32+,37?/m1/s1 |
| InChIKey | DGDGZSVNKNCYAX-RQSGRDBUSA-N |
| XLogP | 7.05 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|