C21H37NO5SSi — CID 101074910
[4-(2-tert-butylanilino)-1-[tert-butyl(dimethyl)silyl]oxy-4-oxobutan-2-yl] methanesulfonate (PubChem CID 101074910) has the molecular formula C21H37NO5SSi and a molecular weight of 443.68 g/mol. Its IUPAC name is [4-(2-tert-butylanilino)-1-[tert-butyl(dimethyl)silyl]oxy-4-oxobutan-2-yl] methanesulfonate.
| Compound Name | [4-(2-tert-butylanilino)-1-[tert-butyl(dimethyl)silyl]oxy-4-oxobutan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 101074910 |
| Molecular Formula | C21H37NO5SSi |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | [4-(2-tert-butylanilino)-1-[tert-butyl(dimethyl)silyl]oxy-4-oxobutan-2-yl] methanesulfonate |
| SMILES | CC(C)(C)c1ccccc1NC(=O)CC(CO[Si](C)(C)C(C)(C)C)OS(C)(=O)=O |
| InChI | InChI=1S/C21H37NO5SSi/c1-20(2,3)17-12-10-11-13-18(17)22-19(23)14-16(27-28(7,24)25)15-26-29(8,9)21(4,5)6/h10-13,16H,14-15H2,1-9H3,(H,22,23) |
| InChIKey | BXMMXGZCJCQDAF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|