C42H45N3O3 — CID 101074951
(4S)-4-benzyl-2-[[3,5-bis[[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-2,4,6-trimethylphenyl]methyl]-4,5-dihydro-1,3-oxazole (PubChem CID 101074951) has the molecular formula C42H45N3O3 and a molecular weight of 639.84 g/mol. Its IUPAC name is (4S)-4-benzyl-2-[[3,5-bis[[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-2,4,6-trimethylphenyl]methyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-benzyl-2-[[3,5-bis[[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-2,4,6-trimethylphenyl]methyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 101074951 |
| Molecular Formula | C42H45N3O3 |
| Molecular Weight | 639.84 g/mol |
| Exact Mass | 639.35 |
| IUPAC Name | (4S)-4-benzyl-2-[[3,5-bis[[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-2,4,6-trimethylphenyl]methyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1c(CC2=N[C@@H](Cc3ccccc3)CO2)c(C)c(CC2=N[C@@H](Cc3ccccc3)CO2)c(C)c1CC1=N[C@@H](Cc2ccccc2)CO1 |
| InChI | InChI=1S/C42H45N3O3/c1-28-37(22-40-43-34(25-46-40)19-31-13-7-4-8-14-31)29(2)39(24-42-45-36(27-48-42)21-33-17-11-6-12-18-33)30(3)38(28)23-41-44-35(26-47-41)20-32-15-9-5-10-16-32/h4-18,34-36H,19-27H2,1-3H3/t34-,35-,36-/m0/s1 |
| InChIKey | GDCPZJPNRGABMA-KVBYWJEESA-N |
| XLogP | 7.36 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.84 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |