C15H16O — CID 101075610
(11R)-12-ethenyl-11-methoxytricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraene (PubChem CID 101075610) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (11R)-12-ethenyl-11-methoxytricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraene.
| Compound Name | (11R)-12-ethenyl-11-methoxytricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 101075610 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (11R)-12-ethenyl-11-methoxytricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraene |
| SMILES | C=CC1C2C=C[C@@H](OC)C1c1ccccc12 |
| InChI | InChI=1S/C15H16O/c1-3-10-12-8-9-14(16-2)15(10)13-7-5-4-6-11(12)13/h3-10,12,14-15H,1H2,2H3/t10?,12?,14-,15?/m1/s1 |
| InChIKey | QARDWSKAFZVJFZ-SPWJRDSTSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|