C25H38N2O10 — CID 101075657
tert-butyl (2S)-3-methyl-2-[[(2S)-3-phenyl-2-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonylamino]propanoyl]amino]butanoate (PubChem CID 101075657) has the molecular formula C25H38N2O10 and a molecular weight of 526.58 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[(2S)-3-phenyl-2-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonylamino]propanoyl]amino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[(2S)-3-phenyl-2-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonylamino]propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 101075657 |
| Molecular Formula | C25H38N2O10 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[(2S)-3-phenyl-2-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonylamino]propanoyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H38N2O10/c1-13(2)17(22(33)37-25(3,4)5)27-21(32)15(11-14-9-7-6-8-10-14)26-24(34)36-23-20(31)19(30)18(29)16(12-28)35-23/h6-10,13,15-20,23,28-31H,11-12H2,1-5H3,(H,26,34)(H,27,32)/t15-,16+,17-,18-,19-,20+,23-/m0/s1 |
| InChIKey | JFDWWVVBZWIRIT-UDSRJDOZSA-N |
| XLogP | -0.39 |
| TPSA | 183.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |