C15H29NO2 — CID 101075964
(E)-N,N-diethyl-6-hydroxy-3,4,7-trimethyloct-3-enamide (PubChem CID 101075964) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is (E)-N,N-diethyl-6-hydroxy-3,4,7-trimethyloct-3-enamide.
| Compound Name | (E)-N,N-diethyl-6-hydroxy-3,4,7-trimethyloct-3-enamide |
|---|---|
| PubChem CID | 101075964 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | (E)-N,N-diethyl-6-hydroxy-3,4,7-trimethyloct-3-enamide |
| SMILES | CCN(CC)C(=O)C/C(C)=C(\C)CC(O)C(C)C |
| InChI | InChI=1S/C15H29NO2/c1-7-16(8-2)15(18)10-13(6)12(5)9-14(17)11(3)4/h11,14,17H,7-10H2,1-6H3/b13-12+ |
| InChIKey | PLQBOFMQQKOWCQ-OUKQBFOZSA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|