About ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate
ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate (PubChem CID 10107611) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate.
Molecular Properties
| Compound Name | ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate |
| PubChem CID | 10107611 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate |
| SMILES | C=C(C)[C@H]1CC=C(C)[C@@H](C(=O)CCCC(=O)OCC)C1 |
| InChI | InChI=1S/C17H26O3/c1-5-20-17(19)8-6-7-16(18)15-11-14(12(2)3)10-9-13(15)4/h9,14-15H,2,5-8,10-11H2,1,3-4H3/t14-,15-/m0/s1 |
| InChIKey | XBTKFQJGQDMFDF-GJZGRUSLSA-N |
| XLogP | 3.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate?
The IUPAC name of ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate (CID 10107611) is ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate.
What is the SMILES notation for ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate?
The canonical SMILES for ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate is C=C(C)[C@H]1CC=C(C)[C@@H](C(=O)CCCC(=O)OCC)C1.
What is the InChIKey of ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate?
The InChIKey is XBTKFQJGQDMFDF-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H26O3/c1-5-20-17(19)8-6-7-16(18)15-11-14(12(2)3)10-9-13(15)4/h9,14-15H,2,5-8,10-11H2,1,3-4H3/t14-,15-/m0/s1.
What are the key properties of ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate?
ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate has a molecular weight of 278.39 g/mol, XLogP of 3.84, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(1S,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-oxopentanoate is sourced from PubChem (CID 10107611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).