C24H26NO+ — CID 101076247
[4-[(2-ethylphenyl)-(4-methoxyphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 101076247) has the molecular formula C24H26NO+ and a molecular weight of 344.48 g/mol. Its IUPAC name is [4-[(2-ethylphenyl)-(4-methoxyphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[(2-ethylphenyl)-(4-methoxyphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 101076247 |
| Molecular Formula | C24H26NO+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [4-[(2-ethylphenyl)-(4-methoxyphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CCc1ccccc1C(=C1C=CC(=[N+](C)C)C=C1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H26NO/c1-5-18-8-6-7-9-23(18)24(20-12-16-22(26-4)17-13-20)19-10-14-21(15-11-19)25(2)3/h6-17H,5H2,1-4H3/q+1 |
| InChIKey | NNTNABHUTPLUFA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|