About 2-acetyl-1H-imidazole-4,5-dicarboxamide
2-acetyl-1H-imidazole-4,5-dicarboxamide (PubChem CID 101076456) has the molecular formula C7H8N4O3
and a molecular weight of 196.17 g/mol. Its IUPAC name is 2-acetyl-1H-imidazole-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-acetyl-1H-imidazole-4,5-dicarboxamide |
| PubChem CID | 101076456 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-acetyl-1H-imidazole-4,5-dicarboxamide |
| SMILES | CC(=O)c1nc(C(N)=O)c(C(N)=O)[nH]1 |
| InChI | InChI=1S/C7H8N4O3/c1-2(12)7-10-3(5(8)13)4(11-7)6(9)14/h1H3,(H2,8,13)(H2,9,14)(H,10,11) |
| InChIKey | XDMDKCFBPINDEW-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetyl-1H-imidazole-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-1H-imidazole-4,5-dicarboxamide?
The IUPAC name of 2-acetyl-1H-imidazole-4,5-dicarboxamide (CID 101076456) is 2-acetyl-1H-imidazole-4,5-dicarboxamide.
What is the SMILES notation for 2-acetyl-1H-imidazole-4,5-dicarboxamide?
The canonical SMILES for 2-acetyl-1H-imidazole-4,5-dicarboxamide is CC(=O)c1nc(C(N)=O)c(C(N)=O)[nH]1.
What is the InChIKey of 2-acetyl-1H-imidazole-4,5-dicarboxamide?
The InChIKey is XDMDKCFBPINDEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O3/c1-2(12)7-10-3(5(8)13)4(11-7)6(9)14/h1H3,(H2,8,13)(H2,9,14)(H,10,11).
What are the key properties of 2-acetyl-1H-imidazole-4,5-dicarboxamide?
2-acetyl-1H-imidazole-4,5-dicarboxamide has a molecular weight of 196.17 g/mol, XLogP of -1.19, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-1H-imidazole-4,5-dicarboxamide is sourced from PubChem (CID 101076456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).