C10H17O5P — CID 101076932
(1R,2R,6R,8R)-11-hydroxy-4,4-dimethyl-3,5,7-trioxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide (PubChem CID 101076932) has the molecular formula C10H17O5P and a molecular weight of 248.21 g/mol. Its IUPAC name is (1R,2R,6R,8R)-11-hydroxy-4,4-dimethyl-3,5,7-trioxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide.
| Compound Name | (1R,2R,6R,8R)-11-hydroxy-4,4-dimethyl-3,5,7-trioxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide |
|---|---|
| PubChem CID | 101076932 |
| Molecular Formula | C10H17O5P |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (1R,2R,6R,8R)-11-hydroxy-4,4-dimethyl-3,5,7-trioxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane 11-oxide |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CCP(=O)(O)C[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C10H17O5P/c1-10(2)14-8-6-5-16(11,12)4-3-7(6)13-9(8)15-10/h6-9H,3-5H2,1-2H3,(H,11,12)/t6-,7-,8-,9-/m1/s1 |
| InChIKey | OZSMTGVJWVWCQB-FNCVBFRFSA-N |
| XLogP | 1.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|