C10H16O6 — CID 101077453
(2R,5R,8S,10R)-4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol (PubChem CID 101077453) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is (2R,5R,8S,10R)-4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol.
| Compound Name | (2R,5R,8S,10R)-4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol |
|---|---|
| PubChem CID | 101077453 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (2R,5R,8S,10R)-4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol |
| SMILES | O[C@H]1CO[C@]2(CO[C@]3(CO2)C[C@@H](O)CO3)C1 |
| InChI | InChI=1S/C10H16O6/c11-7-1-9(13-3-7)5-16-10(6-15-9)2-8(12)4-14-10/h7-8,11-12H,1-6H2/t7-,8-,9-,10+/m1/s1 |
| InChIKey | MFWNKUIDGSGXMP-KYXWUPHJSA-N |
| XLogP | -1.01 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |