About (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine
(3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine (PubChem CID 101077579) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine.
Molecular Properties
| Compound Name | (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine |
| PubChem CID | 101077579 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine |
| SMILES | COCCN1C[C@@H](c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H23NO/c1-21-13-12-20-14-18(16-8-4-2-5-9-16)19(15-20)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3/t18-,19-/m0/s1 |
| InChIKey | TVBQBSRSDVCWHU-OALUTQOASA-N |
| XLogP | 3.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine?
The IUPAC name of (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine (CID 101077579) is (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine.
What is the SMILES notation for (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine?
The canonical SMILES for (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine is COCCN1C[C@@H](c2ccccc2)[C@H](c2ccccc2)C1.
What is the InChIKey of (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine?
The InChIKey is TVBQBSRSDVCWHU-OALUTQOASA-N. The full InChI is InChI=1S/C19H23NO/c1-21-13-12-20-14-18(16-8-4-2-5-9-16)19(15-20)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3/t18-,19-/m0/s1.
What are the key properties of (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine?
(3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine has a molecular weight of 281.40 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-1-(2-methoxyethyl)-3,4-diphenylpyrrolidine is sourced from PubChem (CID 101077579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).