About 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile
5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile (PubChem CID 10107774) has the molecular formula C18H23N3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile |
| PubChem CID | 10107774 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile |
| SMILES | CN(C)C[C@@H]1CCC[C@H]1c1ccc2c(c1)c(C#N)cn2C |
| InChI | InChI=1S/C18H23N3/c1-20(2)11-14-5-4-6-16(14)13-7-8-18-17(9-13)15(10-19)12-21(18)3/h7-9,12,14,16H,4-6,11H2,1-3H3/t14-,16-/m0/s1 |
| InChIKey | MTLYLLNBEUJEJH-HOCLYGCPSA-N |
| XLogP | 3.50 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile?
The IUPAC name of 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile (CID 10107774) is 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile.
What is the SMILES notation for 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile?
The canonical SMILES for 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile is CN(C)C[C@@H]1CCC[C@H]1c1ccc2c(c1)c(C#N)cn2C.
What is the InChIKey of 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile?
The InChIKey is MTLYLLNBEUJEJH-HOCLYGCPSA-N. The full InChI is InChI=1S/C18H23N3/c1-20(2)11-14-5-4-6-16(14)13-7-8-18-17(9-13)15(10-19)12-21(18)3/h7-9,12,14,16H,4-6,11H2,1-3H3/t14-,16-/m0/s1.
What are the key properties of 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile?
5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile has a molecular weight of 281.40 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R,2R)-2-[(dimethylamino)methyl]cyclopentyl]-1-methylindole-3-carbonitrile is sourced from PubChem (CID 10107774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).