C13H17NO3 — CID 101078023
(4aR,5S)-5-methoxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile (PubChem CID 101078023) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (4aR,5S)-5-methoxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile.
| Compound Name | (4aR,5S)-5-methoxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile |
|---|---|
| PubChem CID | 101078023 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (4aR,5S)-5-methoxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile |
| SMILES | CO[C@H]1C=CCC2OC(C)(C)CC(=O)[C@]21C#N |
| InChI | InChI=1S/C13H17NO3/c1-12(2)7-9(15)13(8-14)10(16-3)5-4-6-11(13)17-12/h4-5,10-11H,6-7H2,1-3H3/t10-,11?,13-/m0/s1 |
| InChIKey | MZDHYMPSFIHMMM-BJEKPXQXSA-N |
| XLogP | 1.61 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|