C18H22O5S — CID 101078024
(4aS,5S)-4a-(benzenesulfonyl)-5-methoxy-2,2-dimethyl-3,5,8,8a-tetrahydrochromen-4-one (PubChem CID 101078024) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is (4aS,5S)-4a-(benzenesulfonyl)-5-methoxy-2,2-dimethyl-3,5,8,8a-tetrahydrochromen-4-one.
| Compound Name | (4aS,5S)-4a-(benzenesulfonyl)-5-methoxy-2,2-dimethyl-3,5,8,8a-tetrahydrochromen-4-one |
|---|---|
| PubChem CID | 101078024 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (4aS,5S)-4a-(benzenesulfonyl)-5-methoxy-2,2-dimethyl-3,5,8,8a-tetrahydrochromen-4-one |
| SMILES | CO[C@H]1C=CCC2OC(C)(C)CC(=O)[C@]21S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O5S/c1-17(2)12-14(19)18(15(22-3)10-7-11-16(18)23-17)24(20,21)13-8-5-4-6-9-13/h4-10,15-16H,11-12H2,1-3H3/t15-,16?,18+/m0/s1 |
| InChIKey | BMAQMQZHRHUYSW-NANQTSIFSA-N |
| XLogP | 2.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|