C16H11Br — CID 10107850
9-bromo-2-methylidenetricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene (PubChem CID 10107850) has the molecular formula C16H11Br and a molecular weight of 283.17 g/mol. Its IUPAC name is 9-bromo-2-methylidenetricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene.
| Compound Name | 9-bromo-2-methylidenetricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 10107850 |
| Molecular Formula | C16H11Br |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 9-bromo-2-methylidenetricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene |
| SMILES | C=C1c2ccccc2C=C(Br)c2ccccc21 |
| InChI | InChI=1S/C16H11Br/c1-11-13-7-3-2-6-12(13)10-16(17)15-9-5-4-8-14(11)15/h2-10H,1H2 |
| InChIKey | NMENGYONQPCDED-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|